misk faresi ne demek?

1. (kemirgen, Fam: Cricetidae).

misk amberi

1. Formülü CH3C6H(NO2)2(OCH3)C(CH3)3 olan parfümeride kullanılan ağır kokulu ,beyaz sarımsı toz madde.
2. Musk ambrette.
3. Fr.musk ambrette, musk ambr

misk çiçeği

1. İkiçenekliler sınıfından, güzel kokulu, çimenli ve kuru yerleri tercih eden bir çiçek türü.
2. Field scabious

fare

1. Sıçangillerden, küçük vücutlu, kemirgen, memeli hayvan (Mus).
2. Sıçan.
3. Memeliler (Mammalia) sınıfının, kemiriciler (Rodentia) takımından, sıçanımsılar'a (Myomorpha) mensup memelilerin genel adı.
4. Dormouse.
5. To go; to pass; to journey; to travel.
6. To be in any state, or pass through any experience, good or bad; to be attended with any circummstances or train of events, fortunate or unfortunate; as, he fared well, or ill.
7. To be treated or entertained at table, or with bodily or social comforts; to live.
8. To happen well, or ill; used impersonally; as, we shall see how it will fare with him.
9. To behave; to conduct one's self.
10. Journey; a passage.

Türetilmiş Kelimeler (bis)